C30H24N4 — CID 87989941
2-(2,3,4,5-tetramethylphenyl)porphyrin (PubChem CID 87989941) has the molecular formula C30H24N4 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-(2,3,4,5-tetramethylphenyl)porphyrin.
| Compound Name | 2-(2,3,4,5-tetramethylphenyl)porphyrin |
|---|---|
| PubChem CID | 87989941 |
| Molecular Formula | C30H24N4 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-(2,3,4,5-tetramethylphenyl)porphyrin |
| SMILES | Cc1cc(C2=CC3=N/C2=C\C2=N/C(=C\C4=N/C(=C\C5=N/C(=C\3)C=C5)C=C4)C=C2)c(C)c(C)c1C |
| InChI | InChI=1S/C30H24N4/c1-17-11-28(20(4)19(3)18(17)2)29-15-27-14-25-8-7-23(32-25)12-21-5-6-22(31-21)13-24-9-10-26(33-24)16-30(29)34-27/h5-16H,1-4H3/b21-12-,22-13-,23-12-,24-13-,25-14-,26-16-,27-14-,30-16- |
| InChIKey | CPKFQARNPUDBBP-BAIYJMLFSA-N |
| XLogP | 6.34 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |