C29H36F6O4Si — CID 87990316
methyl (2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enoate (PubChem CID 87990316) has the molecular formula C29H36F6O4Si and a molecular weight of 590.68 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enoate.
| Compound Name | methyl (2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enoate |
|---|---|
| PubChem CID | 87990316 |
| Molecular Formula | C29H36F6O4Si |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | methyl (2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enoate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C(c1ccccc1)[C@H](O[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C29H36F6O4Si/c1-18(17-38-40(7,8)27(3,4)5)24(20-12-10-9-11-13-20)25(26(36)37-6)39-19(2)21-14-22(28(30,31)32)16-23(15-21)29(33,34)35/h9-16,19,24-25H,1,17H2,2-8H3/t19-,24?,25+/m1/s1 |
| InChIKey | XBCKFNUMMOGOGA-LOOXXMCZSA-N |
| XLogP | 8.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|