C17H27N3O3 — CID 8799035
N-[[(2R)-butan-2-yl]carbamoyl]-2-[(4-ethoxyphenyl)methyl-methylamino]acetamide (PubChem CID 8799035) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[[(2R)-butan-2-yl]carbamoyl]-2-[(4-ethoxyphenyl)methyl-methylamino]acetamide.
| Compound Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-[(4-ethoxyphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 8799035 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-[(4-ethoxyphenyl)methyl-methylamino]acetamide |
| SMILES | CCOc1ccc(CN(C)CC(=O)NC(=O)N[C@H](C)CC)cc1 |
| InChI | InChI=1S/C17H27N3O3/c1-5-13(3)18-17(22)19-16(21)12-20(4)11-14-7-9-15(10-8-14)23-6-2/h7-10,13H,5-6,11-12H2,1-4H3,(H2,18,19,21,22)/t13-/m1/s1 |
| InChIKey | BHJRKABOLZVGTD-CYBMUJFWSA-N |
| XLogP | 2.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |