C35H53N7O7S — CID 87990625
[2-[4-[2-[2-acetamido-5-[(4-oxo-4-piperidin-1-ylbutyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]anilino]-2-tert-butyl-1-(carboxyamino)-3,3-dimethylbutyl]carbamic acid (PubChem CID 87990625) has the molecular formula C35H53N7O7S and a molecular weight of 715.92 g/mol. Its IUPAC name is [2-[4-[2-[2-acetamido-5-[(4-oxo-4-piperidin-1-ylbutyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]anilino]-2-tert-butyl-1-(carboxyamino)-3,3-dimethylbutyl]carbamic acid.
| Compound Name | [2-[4-[2-[2-acetamido-5-[(4-oxo-4-piperidin-1-ylbutyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]anilino]-2-tert-butyl-1-(carboxyamino)-3,3-dimethylbutyl]carbamic acid |
|---|---|
| PubChem CID | 87990625 |
| Molecular Formula | C35H53N7O7S |
| Molecular Weight | 715.92 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | [2-[4-[2-[2-acetamido-5-[(4-oxo-4-piperidin-1-ylbutyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]anilino]-2-tert-butyl-1-(carboxyamino)-3,3-dimethylbutyl]carbamic acid |
| SMILES | CC(=O)Nc1nc(CCc2ccc(NC(C(NC(=O)O)NC(=O)O)(C(C)(C)C)C(C)(C)C)cc2)c(C(=O)NCCCC(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C35H53N7O7S/c1-22(43)37-30-38-25(27(50-30)28(45)36-19-11-12-26(44)42-20-9-8-10-21-42)18-15-23-13-16-24(17-14-23)41-35(33(2,3)4,34(5,6)7)29(39-31(46)47)40-32(48)49/h13-14,16-17,29,39-41H,8-12,15,18-21H2,1-7H3,(H,36,45)(H,46,47)(H,48,49)(H,37,38,43) |
| InChIKey | QEGSPMBOKIDFFS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 202.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.92 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|