C29H22F3N5O7 — CID 87990666
[3-(1-methyl-6-nitroindol-3-yl)-2,5-dioxo-4-[1-(piperidine-4-carbonyl)indol-3-yl]pyrrol-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87990666) has the molecular formula C29H22F3N5O7 and a molecular weight of 609.52 g/mol. Its IUPAC name is [3-(1-methyl-6-nitroindol-3-yl)-2,5-dioxo-4-[1-(piperidine-4-carbonyl)indol-3-yl]pyrrol-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-(1-methyl-6-nitroindol-3-yl)-2,5-dioxo-4-[1-(piperidine-4-carbonyl)indol-3-yl]pyrrol-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87990666 |
| Molecular Formula | C29H22F3N5O7 |
| Molecular Weight | 609.52 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | [3-(1-methyl-6-nitroindol-3-yl)-2,5-dioxo-4-[1-(piperidine-4-carbonyl)indol-3-yl]pyrrol-1-yl] 2,2,2-trifluoroacetate |
| SMILES | Cn1cc(C2=C(c3cn(C(=O)C4CCNCC4)c4ccccc34)C(=O)N(OC(=O)C(F)(F)F)C2=O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C29H22F3N5O7/c1-34-13-19(18-7-6-16(37(42)43)12-22(18)34)23-24(27(40)36(26(23)39)44-28(41)29(30,31)32)20-14-35(21-5-3-2-4-17(20)21)25(38)15-8-10-33-11-9-15/h2-7,12-15,33H,8-11H2,1H3 |
| InChIKey | QRRCKQNORNNAFI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|