C20H26F3NO6 — CID 87990874
ethyl 2-[(3R)-6-cyclohexyl-1-oxo-1-(2,2,2-trifluoroacetyl)oxyhexan-3-yl]-1,3-oxazole-4-carboxylate (PubChem CID 87990874) has the molecular formula C20H26F3NO6 and a molecular weight of 433.42 g/mol. Its IUPAC name is ethyl 2-[(3R)-6-cyclohexyl-1-oxo-1-(2,2,2-trifluoroacetyl)oxyhexan-3-yl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[(3R)-6-cyclohexyl-1-oxo-1-(2,2,2-trifluoroacetyl)oxyhexan-3-yl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 87990874 |
| Molecular Formula | C20H26F3NO6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | ethyl 2-[(3R)-6-cyclohexyl-1-oxo-1-(2,2,2-trifluoroacetyl)oxyhexan-3-yl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc([C@H](CCCC2CCCCC2)CC(=O)OC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C20H26F3NO6/c1-2-28-18(26)15-12-29-17(24-15)14(10-6-9-13-7-4-3-5-8-13)11-16(25)30-19(27)20(21,22)23/h12-14H,2-11H2,1H3/t14-/m1/s1 |
| InChIKey | KFHPUOZBJNBJHX-CQSZACIVSA-N |
| XLogP | 4.71 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|