About acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid
acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid (PubChem CID 87991243) has the molecular formula C13H24N2O13S
and a molecular weight of 448.40 g/mol. Its IUPAC name is acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid.
Molecular Properties
| Compound Name | acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid |
| PubChem CID | 87991243 |
| Molecular Formula | C13H24N2O13S |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid |
| SMILES | CC(=O)O.CS(=O)(=O)O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.C2H4O2.CH4O3S/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-2(3)4;1-5(2,3)4/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H3,(H,3,4);1H3,(H,2,3,4) |
| InChIKey | LPNZWNULWHZQRC-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 247.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid?
The IUPAC name of acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid (CID 87991243) is acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid.
What is the SMILES notation for acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid?
The canonical SMILES for acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid is CC(=O)O.CS(=O)(=O)O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.
What is the InChIKey of acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid?
The InChIKey is LPNZWNULWHZQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O8.C2H4O2.CH4O3S/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-2(3)4;1-5(2,3)4/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H3,(H,3,4);1H3,(H,2,3,4).
What are the key properties of acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid?
acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid has a molecular weight of 448.40 g/mol, XLogP of -2.48, 11 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methanesulfonic acid is sourced from PubChem (CID 87991243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).