About 10aH-benzo[c]quinolizine
10aH-benzo[c]quinolizine (PubChem CID 87991361) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 10aH-benzo[c]quinolizine.
Molecular Properties
| Compound Name | 10aH-benzo[c]quinolizine |
| PubChem CID | 87991361 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 10aH-benzo[c]quinolizine |
| SMILES | C1=CC2=CC=C3C=CC=CN3C2C=C1 |
| InChI | InChI=1S/C13H11N/c1-2-7-13-11(5-1)8-9-12-6-3-4-10-14(12)13/h1-10,13H |
| InChIKey | UOGFZJRMCBHRQU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10aH-benzo[c]quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10aH-benzo[c]quinolizine?
The IUPAC name of 10aH-benzo[c]quinolizine (CID 87991361) is 10aH-benzo[c]quinolizine.
What is the SMILES notation for 10aH-benzo[c]quinolizine?
The canonical SMILES for 10aH-benzo[c]quinolizine is C1=CC2=CC=C3C=CC=CN3C2C=C1.
What is the InChIKey of 10aH-benzo[c]quinolizine?
The InChIKey is UOGFZJRMCBHRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-7-13-11(5-1)8-9-12-6-3-4-10-14(12)13/h1-10,13H.
What are the key properties of 10aH-benzo[c]quinolizine?
10aH-benzo[c]quinolizine has a molecular weight of 181.24 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10aH-benzo[c]quinolizine is sourced from PubChem (CID 87991361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).