C8H10F5NO2 — CID 87991640
(5S)-5-amino-1,1,1,2,2-pentafluoro-6-methylheptane-3,4-dione (PubChem CID 87991640) has the molecular formula C8H10F5NO2 and a molecular weight of 247.16 g/mol. Its IUPAC name is (5S)-5-amino-1,1,1,2,2-pentafluoro-6-methylheptane-3,4-dione.
| Compound Name | (5S)-5-amino-1,1,1,2,2-pentafluoro-6-methylheptane-3,4-dione |
|---|---|
| PubChem CID | 87991640 |
| Molecular Formula | C8H10F5NO2 |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (5S)-5-amino-1,1,1,2,2-pentafluoro-6-methylheptane-3,4-dione |
| SMILES | CC(C)[C@H](N)C(=O)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F5NO2/c1-3(2)4(14)5(15)6(16)7(9,10)8(11,12)13/h3-4H,14H2,1-2H3/t4-/m0/s1 |
| InChIKey | GOVLKLBADXQIQC-BYPYZUCNSA-N |
| XLogP | 1.31 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|