About dimethylaminomethanol;zinc
dimethylaminomethanol;zinc (PubChem CID 87991931) has the molecular formula C3H9NOZn
and a molecular weight of 140.50 g/mol. Its IUPAC name is dimethylaminomethanol;zinc.
Molecular Properties
| Compound Name | dimethylaminomethanol;zinc |
| PubChem CID | 87991931 |
| Molecular Formula | C3H9NOZn |
| Molecular Weight | 140.50 g/mol |
| Exact Mass | 139.00 |
| IUPAC Name | dimethylaminomethanol;zinc |
| SMILES | CN(C)CO.[Zn] |
| InChI | InChI=1S/C3H9NO.Zn/c1-4(2)3-5;/h5H,3H2,1-2H3; |
| InChIKey | LEWDBBDPBWXXLV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.50 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethylaminomethanol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylaminomethanol;zinc?
The IUPAC name of dimethylaminomethanol;zinc (CID 87991931) is dimethylaminomethanol;zinc.
What is the SMILES notation for dimethylaminomethanol;zinc?
The canonical SMILES for dimethylaminomethanol;zinc is CN(C)CO.[Zn].
What is the InChIKey of dimethylaminomethanol;zinc?
The InChIKey is LEWDBBDPBWXXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.Zn/c1-4(2)3-5;/h5H,3H2,1-2H3;.
What are the key properties of dimethylaminomethanol;zinc?
dimethylaminomethanol;zinc has a molecular weight of 140.50 g/mol, XLogP of -0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylaminomethanol;zinc is sourced from PubChem (CID 87991931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).