About 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide
2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide (PubChem CID 87992492) has the molecular formula C10H23F3N2O2S
and a molecular weight of 292.37 g/mol. Its IUPAC name is 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide |
| PubChem CID | 87992492 |
| Molecular Formula | C10H23F3N2O2S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide |
| SMILES | CCCCC(C)C(C)(C)N.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H21N.CH2F3NO2S/c1-5-6-7-8(2)9(3,4)10;2-1(3,4)8(5,6)7/h8H,5-7,10H2,1-4H3;(H2,5,6,7) |
| InChIKey | SLUOJOMCALPUQN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide?
The IUPAC name of 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide (CID 87992492) is 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide.
What is the SMILES notation for 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide?
The canonical SMILES for 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide is CCCCC(C)C(C)(C)N.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide?
The InChIKey is SLUOJOMCALPUQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.CH2F3NO2S/c1-5-6-7-8(2)9(3,4)10;2-1(3,4)8(5,6)7/h8H,5-7,10H2,1-4H3;(H2,5,6,7).
What are the key properties of 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide?
2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide has a molecular weight of 292.37 g/mol, XLogP of 2.34, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylheptan-2-amine;trifluoromethanesulfonamide is sourced from PubChem (CID 87992492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).