About 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum
1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum (PubChem CID 87992508) has the molecular formula C28H21MoN6-
and a molecular weight of 537.46 g/mol. Its IUPAC name is 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum.
Molecular Properties
| Compound Name | 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum |
| PubChem CID | 87992508 |
| Molecular Formula | C28H21MoN6- |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum |
| SMILES | [Mo].c1ccc(-c2ccn([C-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/C28H21N6.Mo/c1-4-10-22(11-5-1)25-16-19-32(29-25)28(33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;/h1-21H;/q-1; |
| InChIKey | VUAAUPFGPCZAJJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum?
The IUPAC name of 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum (CID 87992508) is 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum.
What is the SMILES notation for 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum?
The canonical SMILES for 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum is [Mo].c1ccc(-c2ccn([C-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1.
What is the InChIKey of 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum?
The InChIKey is VUAAUPFGPCZAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21N6.Mo/c1-4-10-22(11-5-1)25-16-19-32(29-25)28(33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;/h1-21H;/q-1;.
What are the key properties of 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum?
1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum has a molecular weight of 537.46 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(3-phenylpyrazol-1-yl)methyl]-3-phenylpyrazole;molybdenum is sourced from PubChem (CID 87992508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).