C24H27FO — CID 87992522
5-[(4-fluorophenyl)methoxy]-1,1,4,4-tetramethyl-7-prop-2-ynyl-2,3-dihydronaphthalene (PubChem CID 87992522) has the molecular formula C24H27FO and a molecular weight of 350.48 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methoxy]-1,1,4,4-tetramethyl-7-prop-2-ynyl-2,3-dihydronaphthalene.
| Compound Name | 5-[(4-fluorophenyl)methoxy]-1,1,4,4-tetramethyl-7-prop-2-ynyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 87992522 |
| Molecular Formula | C24H27FO |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 5-[(4-fluorophenyl)methoxy]-1,1,4,4-tetramethyl-7-prop-2-ynyl-2,3-dihydronaphthalene |
| SMILES | C#CCc1cc(OCc2ccc(F)cc2)c2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H27FO/c1-6-7-18-14-20-22(24(4,5)13-12-23(20,2)3)21(15-18)26-16-17-8-10-19(25)11-9-17/h1,8-11,14-15H,7,12-13,16H2,2-5H3 |
| InChIKey | ULFORZGMMQMLHF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|