C12H2Br14O — CID 87992582
1,1,2,2,3,3,4,4,5,5,6-undecabromo-6-(2,3,4-tribromophenoxy)cyclohexane (PubChem CID 87992582) has the molecular formula C12H2Br14O and a molecular weight of 1280.80 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecabromo-6-(2,3,4-tribromophenoxy)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecabromo-6-(2,3,4-tribromophenoxy)cyclohexane |
|---|---|
| PubChem CID | 87992582 |
| Molecular Formula | C12H2Br14O |
| Molecular Weight | 1280.80 g/mol |
| Exact Mass | 1266.87 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecabromo-6-(2,3,4-tribromophenoxy)cyclohexane |
| SMILES | Brc1ccc(OC2(Br)C(Br)(Br)C(Br)(Br)C(Br)(Br)C(Br)(Br)C2(Br)Br)c(Br)c1Br |
| InChI | InChI=1S/C12H2Br14O/c13-3-1-2-4(6(15)5(3)14)27-12(26)10(22,23)8(18,19)7(16,17)9(20,21)11(12,24)25/h1-2H |
| InChIKey | BIOQBIBXEMBZPM-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1280.80 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|