C10H5Cl7O3 — CID 87992837
[2,3,5,6-tetrachloro-4-(hydroxymethyl)phenyl]methyl 2,2,2-trichloroacetate (PubChem CID 87992837) has the molecular formula C10H5Cl7O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is [2,3,5,6-tetrachloro-4-(hydroxymethyl)phenyl]methyl 2,2,2-trichloroacetate.
| Compound Name | [2,3,5,6-tetrachloro-4-(hydroxymethyl)phenyl]methyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 87992837 |
| Molecular Formula | C10H5Cl7O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 417.81 |
| IUPAC Name | [2,3,5,6-tetrachloro-4-(hydroxymethyl)phenyl]methyl 2,2,2-trichloroacetate |
| SMILES | O=C(OCc1c(Cl)c(Cl)c(CO)c(Cl)c1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H5Cl7O3/c11-5-3(1-18)6(12)8(14)4(7(5)13)2-20-9(19)10(15,16)17/h18H,1-2H2 |
| InChIKey | DFWIAORSELNFBK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|