C29H24F7N3O3S — CID 87992932
2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-(2,3-dioxothiomorpholin-4-yl)-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethylpropanamide (PubChem CID 87992932) has the molecular formula C29H24F7N3O3S and a molecular weight of 627.58 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-(2,3-dioxothiomorpholin-4-yl)-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethylpropanamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-(2,3-dioxothiomorpholin-4-yl)-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 87992932 |
| Molecular Formula | C29H24F7N3O3S |
| Molecular Weight | 627.58 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-(2,3-dioxothiomorpholin-4-yl)-4-(4-fluoro-2-methylphenyl)-3-pyridinyl]-N,2-dimethylpropanamide |
| SMILES | Cc1cc(F)ccc1-c1cc(N2CCSC(=O)C2=O)ncc1N(C)C(=O)C(C)(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H24F7N3O3S/c1-15-9-19(30)5-6-20(15)21-13-23(39-7-8-43-25(41)24(39)40)37-14-22(21)38(4)26(42)27(2,3)16-10-17(28(31,32)33)12-18(11-16)29(34,35)36/h5-6,9-14H,7-8H2,1-4H3 |
| InChIKey | BTRCGBWJZLBKOI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.58 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|