C25H13BF15N — CID 87993239
1-azabicyclo[2.2.2]octane;tris(2,3,4,5,6-pentafluorophenyl)borane (PubChem CID 87993239) has the molecular formula C25H13BF15N and a molecular weight of 623.17 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;tris(2,3,4,5,6-pentafluorophenyl)borane.
| Compound Name | 1-azabicyclo[2.2.2]octane;tris(2,3,4,5,6-pentafluorophenyl)borane |
|---|---|
| PubChem CID | 87993239 |
| Molecular Formula | C25H13BF15N |
| Molecular Weight | 623.17 g/mol |
| Exact Mass | 623.09 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;tris(2,3,4,5,6-pentafluorophenyl)borane |
| SMILES | C1CN2CCC1CC2.Fc1c(F)c(F)c(B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18BF15.C7H13N/c20-4-1(5(21)11(27)16(32)10(4)26)19(2-6(22)12(28)17(33)13(29)7(2)23)3-8(24)14(30)18(34)15(31)9(3)25;1-4-8-5-2-7(1)3-6-8/h;7H,1-6H2 |
| InChIKey | JVYWRIUGDSPGFU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.17 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|