C21H19Cl2OZr — CID 87993521
2-[2-(9-methyl-1,9-dihydrofluoren-1-id-2-yl)cyclopenta-1,4-dien-1-yl]ethanol;zirconium(3+);dichloride (PubChem CID 87993521) has the molecular formula C21H19Cl2OZr and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[2-(9-methyl-1,9-dihydrofluoren-1-id-2-yl)cyclopenta-1,4-dien-1-yl]ethanol;zirconium(3+);dichloride.
| Compound Name | 2-[2-(9-methyl-1,9-dihydrofluoren-1-id-2-yl)cyclopenta-1,4-dien-1-yl]ethanol;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 87993521 |
| Molecular Formula | C21H19Cl2OZr |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | 2-[2-(9-methyl-1,9-dihydrofluoren-1-id-2-yl)cyclopenta-1,4-dien-1-yl]ethanol;zirconium(3+);dichloride |
| SMILES | CC1c2[c-]c(C3=C(CCO)C=CC3)ccc2-c2ccccc21.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C21H19O.2ClH.Zr/c1-14-17-6-2-3-7-19(17)20-10-9-16(13-21(14)20)18-8-4-5-15(18)11-12-22;;;/h2-7,9-10,14,22H,8,11-12H2,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | KQKNHLQJZJFMRY-UHFFFAOYSA-L |
| XLogP | -1.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|