C22H10BF15O — CID 87993620
ethoxyethane;tris(2,3,4,5,6-pentafluorophenyl)borane (PubChem CID 87993620) has the molecular formula C22H10BF15O and a molecular weight of 586.10 g/mol. Its IUPAC name is ethoxyethane;tris(2,3,4,5,6-pentafluorophenyl)borane.
| Compound Name | ethoxyethane;tris(2,3,4,5,6-pentafluorophenyl)borane |
|---|---|
| PubChem CID | 87993620 |
| Molecular Formula | C22H10BF15O |
| Molecular Weight | 586.10 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | ethoxyethane;tris(2,3,4,5,6-pentafluorophenyl)borane |
| SMILES | CCOCC.Fc1c(F)c(F)c(B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18BF15.C4H10O/c20-4-1(5(21)11(27)16(32)10(4)26)19(2-6(22)12(28)17(33)13(29)7(2)23)3-8(24)14(30)18(34)15(31)9(3)25;1-3-5-4-2/h;3-4H2,1-2H3 |
| InChIKey | VFVOXTITHWGSMF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.10 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|