About dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol
dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol (PubChem CID 87993803) has the molecular formula C27H26Cl2OZr-2
and a molecular weight of 528.63 g/mol. Its IUPAC name is dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol.
Molecular Properties
| Compound Name | dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol |
| PubChem CID | 87993803 |
| Molecular Formula | C27H26Cl2OZr-2 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol |
| SMILES | CC(C)=[Zr](Cl)Cl.OCCc1c[cH-]c2ccccc12.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C11H11O.C3H6.2ClH.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;12-8-7-10-6-5-9-3-1-2-4-11(9)10;1-3-2;;;/h1-9H;1-6,12H,7-8H2;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | DHTRQNIDUISUQZ-UHFFFAOYSA-L |
| XLogP | 7.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol?
The IUPAC name of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol (CID 87993803) is dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol.
What is the SMILES notation for dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol?
The canonical SMILES for dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol is CC(C)=[Zr](Cl)Cl.OCCc1c[cH-]c2ccccc12.c1ccc2c(c1)[cH-]c1ccccc12.
What is the InChIKey of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol?
The InChIKey is DHTRQNIDUISUQZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H9.C11H11O.C3H6.2ClH.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;12-8-7-10-6-5-9-3-1-2-4-11(9)10;1-3-2;;;/h1-9H;1-6,12H,7-8H2;1-2H3;2*1H;/q2*-1;;;;+2/p-2.
What are the key properties of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol?
dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol has a molecular weight of 528.63 g/mol, XLogP of 7.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;2-(3H-inden-3-id-1-yl)ethanol is sourced from PubChem (CID 87993803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).