C14H15N — CID 87994494
4-ethynyl-5-methyl-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 87994494) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-ethynyl-5-methyl-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 4-ethynyl-5-methyl-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 87994494 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-ethynyl-5-methyl-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | C#Cc1cc2c(cc1C)C1CNCC2C1 |
| InChI | InChI=1S/C14H15N/c1-3-10-6-14-12-5-11(7-15-8-12)13(14)4-9(10)2/h1,4,6,11-12,15H,5,7-8H2,2H3 |
| InChIKey | DGQALMKGSFBNHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|