C28H26N2O3S — CID 87994845
(5E)-5-[[3-[5-(1-adamantyl)-2-methyl-1,3-benzoxazol-7-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87994845) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is (5E)-5-[[3-[5-(1-adamantyl)-2-methyl-1,3-benzoxazol-7-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-[5-(1-adamantyl)-2-methyl-1,3-benzoxazol-7-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87994845 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (5E)-5-[[3-[5-(1-adamantyl)-2-methyl-1,3-benzoxazol-7-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1nc2cc(C34CC5CC(CC(C5)C3)C4)cc(-c3cccc(/C=C4/SC(=O)NC4=O)c3)c2o1 |
| InChI | InChI=1S/C28H26N2O3S/c1-15-29-23-11-21(28-12-17-5-18(13-28)7-19(6-17)14-28)10-22(25(23)33-15)20-4-2-3-16(8-20)9-24-26(31)30-27(32)34-24/h2-4,8-11,17-19H,5-7,12-14H2,1H3,(H,30,31,32)/b24-9+ |
| InChIKey | ISFPBFDTONOUCL-PGGKNCGUSA-N |
| XLogP | 6.59 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|