About 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid
2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid (PubChem CID 87995076) has the molecular formula C13H20O6
and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid |
| PubChem CID | 87995076 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid |
| SMILES | C=C(C)C(=O)OCCO.C=CCC(O)C(=C)C(=O)O |
| InChI | InChI=1S/C7H10O3.C6H10O3/c1-3-4-6(8)5(2)7(9)10;1-5(2)6(8)9-4-3-7/h3,6,8H,1-2,4H2,(H,9,10);7H,1,3-4H2,2H3 |
| InChIKey | UXKDQMVMEKXUEP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid (CID 87995076) is 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid.
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid is C=C(C)C(=O)OCCO.C=CCC(O)C(=C)C(=O)O.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid?
The InChIKey is UXKDQMVMEKXUEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C6H10O3/c1-3-4-6(8)5(2)7(9)10;1-5(2)6(8)9-4-3-7/h3,6,8H,1-2,4H2,(H,9,10);7H,1,3-4H2,2H3.
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid?
2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid has a molecular weight of 272.30 g/mol, XLogP of 0.66, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;3-hydroxy-2-methylidenehex-5-enoic acid is sourced from PubChem (CID 87995076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).