C18H19NO6 — CID 87995156
(4R,6R,8S,9E,11E)-17,19-dihydroxy-13-hydroxyimino-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one (PubChem CID 87995156) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is (4R,6R,8S,9E,11E)-17,19-dihydroxy-13-hydroxyimino-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one.
| Compound Name | (4R,6R,8S,9E,11E)-17,19-dihydroxy-13-hydroxyimino-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one |
|---|---|
| PubChem CID | 87995156 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (4R,6R,8S,9E,11E)-17,19-dihydroxy-13-hydroxyimino-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one |
| SMILES | C[C@@H]1C[C@H]2O[C@H]2/C=C/C=C/C(=NO)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H19NO6/c1-10-6-16-15(25-16)5-3-2-4-12(19-23)7-11-8-13(20)9-14(21)17(11)18(22)24-10/h2-5,8-10,15-16,20-21,23H,6-7H2,1H3/b4-2+,5-3+,19-12?/t10-,15+,16-/m1/s1 |
| InChIKey | XGYXHLARGIWLQS-GDWGHMCTSA-N |
| XLogP | 2.30 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|