About propanal;1-propan-2-ylthioxanthen-9-one
propanal;1-propan-2-ylthioxanthen-9-one (PubChem CID 87995354) has the molecular formula C19H20O2S
and a molecular weight of 312.43 g/mol. Its IUPAC name is propanal;1-propan-2-ylthioxanthen-9-one.
Molecular Properties
| Compound Name | propanal;1-propan-2-ylthioxanthen-9-one |
| PubChem CID | 87995354 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | propanal;1-propan-2-ylthioxanthen-9-one |
| SMILES | CC(C)c1cccc2sc3ccccc3c(=O)c12.CCC=O |
| InChI | InChI=1S/C16H14OS.C3H6O/c1-10(2)11-7-5-9-14-15(11)16(17)12-6-3-4-8-13(12)18-14;1-2-3-4/h3-10H,1-2H3;3H,2H2,1H3 |
| InChIKey | YSPARBQVIZCVDB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze propanal;1-propan-2-ylthioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanal;1-propan-2-ylthioxanthen-9-one?
The IUPAC name of propanal;1-propan-2-ylthioxanthen-9-one (CID 87995354) is propanal;1-propan-2-ylthioxanthen-9-one.
What is the SMILES notation for propanal;1-propan-2-ylthioxanthen-9-one?
The canonical SMILES for propanal;1-propan-2-ylthioxanthen-9-one is CC(C)c1cccc2sc3ccccc3c(=O)c12.CCC=O.
What is the InChIKey of propanal;1-propan-2-ylthioxanthen-9-one?
The InChIKey is YSPARBQVIZCVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14OS.C3H6O/c1-10(2)11-7-5-9-14-15(11)16(17)12-6-3-4-8-13(12)18-14;1-2-3-4/h3-10H,1-2H3;3H,2H2,1H3.
What are the key properties of propanal;1-propan-2-ylthioxanthen-9-one?
propanal;1-propan-2-ylthioxanthen-9-one has a molecular weight of 312.43 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanal;1-propan-2-ylthioxanthen-9-one is sourced from PubChem (CID 87995354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).