C10H16S — CID 87995638
(3Z,5E)-6-propylsulfanylhepta-1,3,5-triene (PubChem CID 87995638) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is (3Z,5E)-6-propylsulfanylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-6-propylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 87995638 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (3Z,5E)-6-propylsulfanylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C=C(/C)SCCC |
| InChI | InChI=1S/C10H16S/c1-4-6-7-8-10(3)11-9-5-2/h4,6-8H,1,5,9H2,2-3H3/b7-6-,10-8+ |
| InChIKey | IVMYUBFTACNPTM-VAAURPRASA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|