C23H31ClN6O5S — CID 87995723
2-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]-N,N-dimethyl-2-phenylacetamide;ethanesulfonic acid (PubChem CID 87995723) has the molecular formula C23H31ClN6O5S and a molecular weight of 539.06 g/mol. Its IUPAC name is 2-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]-N,N-dimethyl-2-phenylacetamide;ethanesulfonic acid.
| Compound Name | 2-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]-N,N-dimethyl-2-phenylacetamide;ethanesulfonic acid |
|---|---|
| PubChem CID | 87995723 |
| Molecular Formula | C23H31ClN6O5S |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 2-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]-N,N-dimethyl-2-phenylacetamide;ethanesulfonic acid |
| SMILES | CCS(=O)(=O)O.CN(C)C(=O)C(Oc1ccc(N2C(N)=NC(N)=NC2(C)C)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H25ClN6O2.C2H6O3S/c1-21(2)26-19(23)25-20(24)28(21)14-10-11-16(15(22)12-14)30-17(18(29)27(3)4)13-8-6-5-7-9-13;1-2-6(3,4)5/h5-12,17H,1-4H3,(H4,23,24,25,26);2H2,1H3,(H,3,4,5) |
| InChIKey | UBVXJCHQRULIES-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|