C24H26Br3N5S — CID 87995760
1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea (PubChem CID 87995760) has the molecular formula C24H26Br3N5S and a molecular weight of 656.29 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea.
| Compound Name | 1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea |
|---|---|
| PubChem CID | 87995760 |
| Molecular Formula | C24H26Br3N5S |
| Molecular Weight | 656.29 g/mol |
| Exact Mass | 652.95 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-3-(2,4,6-tribromophenyl)thiourea |
| SMILES | CN(C)c1cc(NC2CCC(NC(=S)Nc3c(Br)cc(Br)cc3Br)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H26Br3N5S/c1-32(2)21-13-22(30-20-6-4-3-5-17(20)21)28-15-7-9-16(10-8-15)29-24(33)31-23-18(26)11-14(25)12-19(23)27/h3-6,11-13,15-16H,7-10H2,1-2H3,(H,28,30)(H2,29,31,33) |
| InChIKey | RUEFCLJXBNWRQM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.29 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|