C26H26NSiZr- — CID 87996308
2-methyl-1H-inden-1-ide;8,8,9-trimethyl-4-phenyl-4-aza-8-silatricyclo[5.1.1.02,6]nona-1(9),2,5-triene;zirconium (PubChem CID 87996308) has the molecular formula C26H26NSiZr- and a molecular weight of 471.81 g/mol. Its IUPAC name is 2-methyl-1H-inden-1-ide;8,8,9-trimethyl-4-phenyl-4-aza-8-silatricyclo[5.1.1.02,6]nona-1(9),2,5-triene;zirconium.
| Compound Name | 2-methyl-1H-inden-1-ide;8,8,9-trimethyl-4-phenyl-4-aza-8-silatricyclo[5.1.1.02,6]nona-1(9),2,5-triene;zirconium |
|---|---|
| PubChem CID | 87996308 |
| Molecular Formula | C26H26NSiZr- |
| Molecular Weight | 471.81 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-methyl-1H-inden-1-ide;8,8,9-trimethyl-4-phenyl-4-aza-8-silatricyclo[5.1.1.02,6]nona-1(9),2,5-triene;zirconium |
| SMILES | CC1=C2c3cn(-c4ccccc4)cc3C1[Si]2(C)C.Cc1cc2ccccc2[cH-]1.[Zr] |
| InChI | InChI=1S/C16H17NSi.C10H9.Zr/c1-11-15-13-9-17(12-7-5-4-6-8-12)10-14(13)16(11)18(15,2)3;1-8-6-9-4-2-3-5-10(9)7-8;/h4-10,15H,1-3H3;2-7H,1H3;/q;-1; |
| InChIKey | SHHUPJXIVWZCAB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.81 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|