C4H7F5N2O4S2 — CID 87996733
N-(dimethylsulfamoyl)-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 87996733) has the molecular formula C4H7F5N2O4S2 and a molecular weight of 306.23 g/mol. Its IUPAC name is N-(dimethylsulfamoyl)-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-(dimethylsulfamoyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 87996733 |
| Molecular Formula | C4H7F5N2O4S2 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | N-(dimethylsulfamoyl)-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H7F5N2O4S2/c1-11(2)17(14,15)10-16(12,13)4(8,9)3(5,6)7/h10H,1-2H3 |
| InChIKey | VMKGPHJLGBDSFF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|