C24H32ClFN4O5S — CID 87996987
(2-aminoethylamino) [5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonate (PubChem CID 87996987) has the molecular formula C24H32ClFN4O5S and a molecular weight of 543.06 g/mol. Its IUPAC name is (2-aminoethylamino) [5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonate.
| Compound Name | (2-aminoethylamino) [5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonate |
|---|---|
| PubChem CID | 87996987 |
| Molecular Formula | C24H32ClFN4O5S |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (2-aminoethylamino) [5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonate |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc1ccc(Cl)cc1CS(=O)(=O)ONCCN |
| InChI | InChI=1S/C24H32ClFN4O5S/c1-17-13-30(18(2)12-29(17)14-19-3-6-22(26)7-4-19)24(31)15-34-23-8-5-21(25)11-20(23)16-36(32,33)35-28-10-9-27/h3-8,11,17-18,28H,9-10,12-16,27H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | KRTQOQKGCZKZAA-ZWKOTPCHSA-N |
| XLogP | 2.29 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|