C15H26O2 — CID 87997072
2-[(1E,3E)-2,3-dimethylnona-1,3-dienyl]-1,3-dioxane (PubChem CID 87997072) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(1E,3E)-2,3-dimethylnona-1,3-dienyl]-1,3-dioxane.
| Compound Name | 2-[(1E,3E)-2,3-dimethylnona-1,3-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 87997072 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(1E,3E)-2,3-dimethylnona-1,3-dienyl]-1,3-dioxane |
| SMILES | CCCCC/C=C(C)/C(C)=C/C1OCCCO1 |
| InChI | InChI=1S/C15H26O2/c1-4-5-6-7-9-13(2)14(3)12-15-16-10-8-11-17-15/h9,12,15H,4-8,10-11H2,1-3H3/b13-9+,14-12+ |
| InChIKey | AWLOIXBMUXRDAG-IHJNGOQESA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|