C30H30ClN3O6 — CID 87997139
N-[2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 87997139) has the molecular formula C30H30ClN3O6 and a molecular weight of 564.04 g/mol. Its IUPAC name is N-[2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 87997139 |
| Molecular Formula | C30H30ClN3O6 |
| Molecular Weight | 564.04 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | N-[2-[[1-[7-chloro-3-[(3-methoxyphenyl)methyl]-4-oxopyrano[2,3-b]pyridin-2-yl]-2-methylpropyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cccc(Cc2c(C(NCCNC(=O)c3ccc4c(c3)OCO4)C(C)C)oc3nc(Cl)ccc3c2=O)c1 |
| InChI | InChI=1S/C30H30ClN3O6/c1-17(2)26(32-11-12-33-29(36)19-7-9-23-24(15-19)39-16-38-23)28-22(14-18-5-4-6-20(13-18)37-3)27(35)21-8-10-25(31)34-30(21)40-28/h4-10,13,15,17,26,32H,11-12,14,16H2,1-3H3,(H,33,36) |
| InChIKey | LGKIRMHONOQFAR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.04 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|