C23H26F6O2 — CID 87997145
3-(2-adamantyl)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid;1,2,3,3,4,4-hexafluorocyclobutene (PubChem CID 87997145) has the molecular formula C23H26F6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 3-(2-adamantyl)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid;1,2,3,3,4,4-hexafluorocyclobutene.
| Compound Name | 3-(2-adamantyl)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid;1,2,3,3,4,4-hexafluorocyclobutene |
|---|---|
| PubChem CID | 87997145 |
| Molecular Formula | C23H26F6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-(2-adamantyl)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid;1,2,3,3,4,4-hexafluorocyclobutene |
| SMILES | CC1(C(=O)O)C2C=CC(C2)C1C1C2CC3CC(C2)CC1C3.FC1=C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C19H26O2.C4F6/c1-19(18(20)21)15-3-2-12(9-15)17(19)16-13-5-10-4-11(7-13)8-14(16)6-10;5-1-2(6)4(9,10)3(1,7)8/h2-3,10-17H,4-9H2,1H3,(H,20,21); |
| InChIKey | MWHHNYOVJLBFBV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|