About cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol
cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol (PubChem CID 87997549) has the molecular formula C31H40O3
and a molecular weight of 460.66 g/mol. Its IUPAC name is cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol.
Molecular Properties
| Compound Name | cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol |
| PubChem CID | 87997549 |
| Molecular Formula | C31H40O3 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol |
| SMILES | C=C(CC)C(=O)OC1CCCCC1.CC(C)Cc1ccc(C=CC=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H22O.C11H18O2/c1-16(2)15-19-9-7-17(8-10-19)5-3-4-6-18-11-13-20(21)14-12-18;1-3-9(2)11(12)13-10-7-5-4-6-8-10/h3-14,16,21H,15H2,1-2H3;10H,2-8H2,1H3 |
| InChIKey | NWEGIYHPHNUEBN-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol?
The IUPAC name of cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol (CID 87997549) is cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol.
What is the SMILES notation for cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol?
The canonical SMILES for cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol is C=C(CC)C(=O)OC1CCCCC1.CC(C)Cc1ccc(C=CC=Cc2ccc(O)cc2)cc1.
What is the InChIKey of cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol?
The InChIKey is NWEGIYHPHNUEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O.C11H18O2/c1-16(2)15-19-9-7-17(8-10-19)5-3-4-6-18-11-13-20(21)14-12-18;1-3-9(2)11(12)13-10-7-5-4-6-8-10/h3-14,16,21H,15H2,1-2H3;10H,2-8H2,1H3.
What are the key properties of cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol?
cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol has a molecular weight of 460.66 g/mol, XLogP of 8.15, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-methylidenebutanoate;4-[4-[4-(2-methylpropyl)phenyl]buta-1,3-dienyl]phenol is sourced from PubChem (CID 87997549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).