2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid

C12H14O10 — CID 87997821

IUPAC2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid
SMILESCCOC(=O)C=C(C(=O)O)C(CC(=O)O)(OC(C)=O)C(=O)O
InChIInChI=1S/C12H14O10/c1-3-21-9(16)4-7(10(17)18)12(11(19)20,5-8(14)15)22-6(2)13/h4H,3,5H2,1-2H3,(H,14,15)(H,17,18)(H,19,20)
InChIKeyMSOFPKWKAURAFF-UHFFFAOYSA-N
MW318.23 g/mol
LogP-0.58
Rot. Bonds8

About 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid

2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid (PubChem CID 87997821) has the molecular formula C12H14O10 and a molecular weight of 318.23 g/mol. Its IUPAC name is 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Name2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid
PubChem CID87997821
Molecular FormulaC12H14O10
Molecular Weight318.23 g/mol
Exact Mass318.06
IUPAC Name2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid
SMILESCCOC(=O)C=C(C(=O)O)C(CC(=O)O)(OC(C)=O)C(=O)O
InChIInChI=1S/C12H14O10/c1-3-21-9(16)4-7(10(17)18)12(11(19)20,5-8(14)15)22-6(2)13/h4H,3,5H2,1-2H3,(H,14,15)(H,17,18)(H,19,20)
InChIKeyMSOFPKWKAURAFF-UHFFFAOYSA-N
XLogP-0.58
TPSA164.50 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.23
LogP ≤ 5-0.58
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid?
The IUPAC name of 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid (CID 87997821) is 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid.
What is the SMILES notation for 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid?
The canonical SMILES for 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid is CCOC(=O)C=C(C(=O)O)C(CC(=O)O)(OC(C)=O)C(=O)O.
What is the InChIKey of 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid?
The InChIKey is MSOFPKWKAURAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O10/c1-3-21-9(16)4-7(10(17)18)12(11(19)20,5-8(14)15)22-6(2)13/h4H,3,5H2,1-2H3,(H,14,15)(H,17,18)(H,19,20).
What are the key properties of 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid?
2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid has a molecular weight of 318.23 g/mol, XLogP of -0.58, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid is sourced from PubChem (CID 87997821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).