C12H14O10 — CID 87997821
2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid (PubChem CID 87997821) has the molecular formula C12H14O10 and a molecular weight of 318.23 g/mol. Its IUPAC name is 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid.
| Compound Name | 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87997821 |
| Molecular Formula | C12H14O10 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-acetyloxy-5-ethoxy-5-oxopent-3-ene-1,2,3-tricarboxylic acid |
| SMILES | CCOC(=O)C=C(C(=O)O)C(CC(=O)O)(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C12H14O10/c1-3-21-9(16)4-7(10(17)18)12(11(19)20,5-8(14)15)22-6(2)13/h4H,3,5H2,1-2H3,(H,14,15)(H,17,18)(H,19,20) |
| InChIKey | MSOFPKWKAURAFF-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|