About 6-chloro-3H-1,2-benzodioxole
6-chloro-3H-1,2-benzodioxole (PubChem CID 87998289) has the molecular formula C7H5ClO2
and a molecular weight of 156.57 g/mol. Its IUPAC name is 6-chloro-3H-1,2-benzodioxole.
Molecular Properties
| Compound Name | 6-chloro-3H-1,2-benzodioxole |
| PubChem CID | 87998289 |
| Molecular Formula | C7H5ClO2 |
| Molecular Weight | 156.57 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | 6-chloro-3H-1,2-benzodioxole |
| SMILES | Clc1ccc2c(c1)OOC2 |
| InChI | InChI=1S/C7H5ClO2/c8-6-2-1-5-4-9-10-7(5)3-6/h1-3H,4H2 |
| InChIKey | WCWMIQSJWKAPAN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3H-1,2-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3H-1,2-benzodioxole?
The IUPAC name of 6-chloro-3H-1,2-benzodioxole (CID 87998289) is 6-chloro-3H-1,2-benzodioxole.
What is the SMILES notation for 6-chloro-3H-1,2-benzodioxole?
The canonical SMILES for 6-chloro-3H-1,2-benzodioxole is Clc1ccc2c(c1)OOC2.
What is the InChIKey of 6-chloro-3H-1,2-benzodioxole?
The InChIKey is WCWMIQSJWKAPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2/c8-6-2-1-5-4-9-10-7(5)3-6/h1-3H,4H2.
What are the key properties of 6-chloro-3H-1,2-benzodioxole?
6-chloro-3H-1,2-benzodioxole has a molecular weight of 156.57 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3H-1,2-benzodioxole is sourced from PubChem (CID 87998289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).