C19H16Cl2N4O4 — CID 87998765
2-chloro-2-(4-chlorophenyl)-2-[4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-methoxy-N-methylacetamide (PubChem CID 87998765) has the molecular formula C19H16Cl2N4O4 and a molecular weight of 435.27 g/mol. Its IUPAC name is 2-chloro-2-(4-chlorophenyl)-2-[4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-chloro-2-(4-chlorophenyl)-2-[4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 87998765 |
| Molecular Formula | C19H16Cl2N4O4 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-chloro-2-(4-chlorophenyl)-2-[4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)C(Cl)(c1ccc(Cl)cc1)c1ccc(-n2ncc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H16Cl2N4O4/c1-24(29-2)17(27)19(21,12-3-7-14(20)8-4-12)13-5-9-15(10-6-13)25-18(28)23-16(26)11-22-25/h3-11H,1-2H3,(H,23,26,28) |
| InChIKey | UKTRJNIUNPOPMM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|