C18H22FN5O4 — CID 87998794
(3R)-7-[(3S)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxylic acid (PubChem CID 87998794) has the molecular formula C18H22FN5O4 and a molecular weight of 391.40 g/mol. Its IUPAC name is (3R)-7-[(3S)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | (3R)-7-[(3S)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 87998794 |
| Molecular Formula | C18H22FN5O4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (3R)-7-[(3S)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CON=C1CN(c2nc3c(cc2F)C[C@@H](C(=O)O)C(=O)N3C2CC2)C[C@@H]1CN |
| InChI | InChI=1S/C18H22FN5O4/c1-28-22-14-8-23(7-10(14)6-20)16-13(19)5-9-4-12(18(26)27)17(25)24(11-2-3-11)15(9)21-16/h5,10-12H,2-4,6-8,20H2,1H3,(H,26,27)/t10-,12+/m0/s1 |
| InChIKey | RYPKZMPPGOWLJV-CMPLNLGQSA-N |
| XLogP | 0.37 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|