C56H54N12O5 — CID 87999021
bis(4-N,4-N-dibenzyl-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine);hydrate (PubChem CID 87999021) has the molecular formula C56H54N12O5 and a molecular weight of 975.13 g/mol. Its IUPAC name is bis(4-N,4-N-dibenzyl-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine);hydrate.
| Compound Name | bis(4-N,4-N-dibenzyl-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine);hydrate |
|---|---|
| PubChem CID | 87999021 |
| Molecular Formula | C56H54N12O5 |
| Molecular Weight | 975.13 g/mol |
| Exact Mass | 974.43 |
| IUPAC Name | bis(4-N,4-N-dibenzyl-6-(3,4-dimethoxyphenyl)pteridine-2,4-diamine);hydrate |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N(Cc4ccccc4)Cc4ccccc4)c3n2)cc1OC.COc1ccc(-c2cnc3nc(N)nc(N(Cc4ccccc4)Cc4ccccc4)c3n2)cc1OC.O |
| InChI | InChI=1S/2C28H26N6O2.H2O/c2*1-35-23-14-13-21(15-24(23)36-2)22-16-30-26-25(31-22)27(33-28(29)32-26)34(17-19-9-5-3-6-10-19)18-20-11-7-4-8-12-20;/h2*3-16H,17-18H2,1-2H3,(H2,29,30,32,33);1H2 |
| InChIKey | GQGVTTIPGLSNMB-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 230.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.13 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |