C20H19NO2 — CID 87999035
benzyl N-[(6-ethynyl-2,3-dihydro-1H-inden-1-yl)methyl]carbamate (PubChem CID 87999035) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is benzyl N-[(6-ethynyl-2,3-dihydro-1H-inden-1-yl)methyl]carbamate.
| Compound Name | benzyl N-[(6-ethynyl-2,3-dihydro-1H-inden-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 87999035 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | benzyl N-[(6-ethynyl-2,3-dihydro-1H-inden-1-yl)methyl]carbamate |
| SMILES | C#Cc1ccc2c(c1)C(CNC(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C20H19NO2/c1-2-15-8-9-17-10-11-18(19(17)12-15)13-21-20(22)23-14-16-6-4-3-5-7-16/h1,3-9,12,18H,10-11,13-14H2,(H,21,22) |
| InChIKey | XEWSHWQMZMNSLI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|