C19H18F9NO6S — CID 87999087
ethyl 4-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroacetyl)oxypropan-2-yl]anilino]-1,1-dioxothiane-4-carboxylate (PubChem CID 87999087) has the molecular formula C19H18F9NO6S and a molecular weight of 559.40 g/mol. Its IUPAC name is ethyl 4-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroacetyl)oxypropan-2-yl]anilino]-1,1-dioxothiane-4-carboxylate.
| Compound Name | ethyl 4-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroacetyl)oxypropan-2-yl]anilino]-1,1-dioxothiane-4-carboxylate |
|---|---|
| PubChem CID | 87999087 |
| Molecular Formula | C19H18F9NO6S |
| Molecular Weight | 559.40 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | ethyl 4-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroacetyl)oxypropan-2-yl]anilino]-1,1-dioxothiane-4-carboxylate |
| SMILES | CCOC(=O)C1(Nc2ccc(C(OC(=O)C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C19H18F9NO6S/c1-2-34-13(30)15(7-9-36(32,33)10-8-15)29-12-5-3-11(4-6-12)16(18(23,24)25,19(26,27)28)35-14(31)17(20,21)22/h3-6,29H,2,7-10H2,1H3 |
| InChIKey | LPLVXABNZVZKKQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |