C16H23NO4 — CID 87999157
(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl) benzenecarboperoxoate (PubChem CID 87999157) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl) benzenecarboperoxoate.
| Compound Name | (4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl) benzenecarboperoxoate |
|---|---|
| PubChem CID | 87999157 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl) benzenecarboperoxoate |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OOC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO4/c1-15(2)10-13(18)11-16(3,4)17(15)21-20-14(19)12-8-6-5-7-9-12/h5-9,13,18H,10-11H2,1-4H3 |
| InChIKey | UODRNVXFBZPNOV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|