C25H32ClN5O5S — CID 87999620
3-[[2-chloro-4-[formyl-[(2-methylpropan-2-yl)oxy]amino]phenyl]methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide (PubChem CID 87999620) has the molecular formula C25H32ClN5O5S and a molecular weight of 550.08 g/mol. Its IUPAC name is 3-[[2-chloro-4-[formyl-[(2-methylpropan-2-yl)oxy]amino]phenyl]methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide.
| Compound Name | 3-[[2-chloro-4-[formyl-[(2-methylpropan-2-yl)oxy]amino]phenyl]methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 87999620 |
| Molecular Formula | C25H32ClN5O5S |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 3-[[2-chloro-4-[formyl-[(2-methylpropan-2-yl)oxy]amino]phenyl]methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)c1ccc2nc(C)n(Cc3ccc(N(C=O)OC(C)(C)C)cc3Cl)c2n1 |
| InChI | InChI=1S/C25H32ClN5O5S/c1-6-7-8-13-37(34,35)29-24(33)22-12-11-21-23(28-22)30(17(2)27-21)15-18-9-10-19(14-20(18)26)31(16-32)36-25(3,4)5/h9-12,14,16H,6-8,13,15H2,1-5H3,(H,29,33) |
| InChIKey | KRTGREWYFOANLN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|