C25H42N2O10S2 — CID 87999646
bis([(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);(2S)-piperazine-2-carboxylic acid (PubChem CID 87999646) has the molecular formula C25H42N2O10S2 and a molecular weight of 594.75 g/mol. Its IUPAC name is bis([(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);(2S)-piperazine-2-carboxylic acid.
| Compound Name | bis([(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);(2S)-piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 87999646 |
| Molecular Formula | C25H42N2O10S2 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | bis([(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid);(2S)-piperazine-2-carboxylic acid |
| SMILES | CC1(C)C2CC[C@@]1(CS(=O)(=O)O)C(=O)C2.CC1(C)C2CC[C@@]1(CS(=O)(=O)O)C(=O)C2.O=C(O)[C@@H]1CNCCN1 |
| InChI | InChI=1S/2C10H16O4S.C5H10N2O2/c2*1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;8-5(9)4-3-6-1-2-7-4/h2*7H,3-6H2,1-2H3,(H,12,13,14);4,6-7H,1-3H2,(H,8,9)/t2*7?,10-;4-/m110/s1 |
| InChIKey | CIDIUNVZQXMGFL-YSENEMGHSA-N |
| XLogP | 1.17 |
| TPSA | 204.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|