C24H27N3O3S — CID 87999696
4-[1-[6-(3-phenylprop-2-ynyl)-1,2,4,5,7,8-hexahydropyrido[4,3-d]pyrimidin-3-yl]ethyl]benzenesulfonic acid (PubChem CID 87999696) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 4-[1-[6-(3-phenylprop-2-ynyl)-1,2,4,5,7,8-hexahydropyrido[4,3-d]pyrimidin-3-yl]ethyl]benzenesulfonic acid.
| Compound Name | 4-[1-[6-(3-phenylprop-2-ynyl)-1,2,4,5,7,8-hexahydropyrido[4,3-d]pyrimidin-3-yl]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87999696 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 4-[1-[6-(3-phenylprop-2-ynyl)-1,2,4,5,7,8-hexahydropyrido[4,3-d]pyrimidin-3-yl]ethyl]benzenesulfonic acid |
| SMILES | CC(c1ccc(S(=O)(=O)O)cc1)N1CNC2=C(CN(CC#Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C24H27N3O3S/c1-19(21-9-11-23(12-10-21)31(28,29)30)27-17-22-16-26(15-13-24(22)25-18-27)14-5-8-20-6-3-2-4-7-20/h2-4,6-7,9-12,19,25H,13-18H2,1H3,(H,28,29,30) |
| InChIKey | DFBZSKQORDYHJK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|