About azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine
azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine (PubChem CID 87999920) has the molecular formula C18H20ClN5
and a molecular weight of 341.85 g/mol. Its IUPAC name is azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine |
| PubChem CID | 87999920 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine |
| SMILES | Cc1cc(C)c(-c2nc(N)ncc2-c2ccc(Cl)nc2)c(C)c1.N |
| InChI | InChI=1S/C18H17ClN4.H3N/c1-10-6-11(2)16(12(3)7-10)17-14(9-22-18(20)23-17)13-4-5-15(19)21-8-13;/h4-9H,1-3H3,(H2,20,22,23);1H3 |
| InChIKey | ZMFGBEWHAHCPDQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
The IUPAC name of azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine (CID 87999920) is azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine.
What is the SMILES notation for azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
The canonical SMILES for azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine is Cc1cc(C)c(-c2nc(N)ncc2-c2ccc(Cl)nc2)c(C)c1.N.
What is the InChIKey of azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
The InChIKey is ZMFGBEWHAHCPDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN4.H3N/c1-10-6-11(2)16(12(3)7-10)17-14(9-22-18(20)23-17)13-4-5-15(19)21-8-13;/h4-9H,1-3H3,(H2,20,22,23);1H3.
What are the key properties of azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine?
azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine has a molecular weight of 341.85 g/mol, XLogP of 4.53, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-(6-chloro-3-pyridinyl)-4-(2,4,6-trimethylphenyl)pyrimidin-2-amine is sourced from PubChem (CID 87999920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).