C11H16N2O4S — CID 8801649
2-[(2-methoxy-5-methylphenyl)sulfonylamino]-N-methylacetamide (PubChem CID 8801649) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[(2-methoxy-5-methylphenyl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(2-methoxy-5-methylphenyl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 8801649 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[(2-methoxy-5-methylphenyl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C11H16N2O4S/c1-8-4-5-9(17-3)10(6-8)18(15,16)13-7-11(14)12-2/h4-6,13H,7H2,1-3H3,(H,12,14) |
| InChIKey | SHGGOMKYMIHWGF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |