C17H13F5N3OS+ — CID 8801901
1,3-benzothiazol-2-ylmethyl-methyl-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]azanium (PubChem CID 8801901) has the molecular formula C17H13F5N3OS+ and a molecular weight of 402.37 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl-methyl-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]azanium.
| Compound Name | 1,3-benzothiazol-2-ylmethyl-methyl-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8801901 |
| Molecular Formula | C17H13F5N3OS+ |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl-methyl-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1c(F)c(F)c(F)c(F)c1F)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H12F5N3OS/c1-25(7-11-23-8-4-2-3-5-9(8)27-11)6-10(26)24-17-15(21)13(19)12(18)14(20)16(17)22/h2-5H,6-7H2,1H3,(H,24,26)/p+1 |
| InChIKey | KSMWEWYMEBMSCQ-UHFFFAOYSA-O |
| XLogP | 2.65 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|