C20H27ClN2O3S — CID 8803123
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)methanone (PubChem CID 8803123) has the molecular formula C20H27ClN2O3S and a molecular weight of 410.97 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 8803123 |
| Molecular Formula | C20H27ClN2O3S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C20H27ClN2O3S/c21-18-8-7-16(13-19(18)27(25,26)23-10-3-4-11-23)20(24)22-12-9-15-5-1-2-6-17(15)14-22/h7-8,13,15,17H,1-6,9-12,14H2/t15-,17-/m0/s1 |
| InChIKey | DIZIUMQHNNQQSK-RDJZCZTQSA-N |
| XLogP | 3.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |